C7H16N4O2 — CID 146415919
2-(methylamino)-N-[2-(methylcarbamoylamino)ethyl]acetamide (PubChem CID 146415919) has the molecular formula C7H16N4O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-(methylamino)-N-[2-(methylcarbamoylamino)ethyl]acetamide.
| Compound Name | 2-(methylamino)-N-[2-(methylcarbamoylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 146415919 |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-(methylamino)-N-[2-(methylcarbamoylamino)ethyl]acetamide |
| SMILES | CNCC(=O)NCCNC(=O)NC |
| InChI | InChI=1S/C7H16N4O2/c1-8-5-6(12)10-3-4-11-7(13)9-2/h8H,3-5H2,1-2H3,(H,10,12)(H2,9,11,13) |
| InChIKey | AWWBCTFAMZQJJV-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|