C12H26N2O4 — CID 177342211
ethane;2-(methylamino)-N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]acetamide (PubChem CID 177342211) has the molecular formula C12H26N2O4 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethane;2-(methylamino)-N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]acetamide.
| Compound Name | ethane;2-(methylamino)-N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 177342211 |
| Molecular Formula | C12H26N2O4 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | ethane;2-(methylamino)-N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]acetamide |
| SMILES | CC.CNCC(=O)NCCOCCOCCC=O |
| InChI | InChI=1S/C10H20N2O4.C2H6/c1-11-9-10(14)12-3-6-16-8-7-15-5-2-4-13;1-2/h4,11H,2-3,5-9H2,1H3,(H,12,14);1-2H3 |
| InChIKey | DPRNBFNMPQEFFZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|