C9H18N2O5 — CID 123264301
2-aminooxy-N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]acetamide (PubChem CID 123264301) has the molecular formula C9H18N2O5 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-aminooxy-N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]acetamide.
| Compound Name | 2-aminooxy-N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 123264301 |
| Molecular Formula | C9H18N2O5 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-aminooxy-N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]acetamide |
| SMILES | NOCC(=O)NCCOCCOCCC=O |
| InChI | InChI=1S/C9H18N2O5/c10-16-8-9(13)11-2-5-15-7-6-14-4-1-3-12/h3H,1-2,4-8,10H2,(H,11,13) |
| InChIKey | NWWOHBJAHYLVIL-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|