C11H24BN4O7 — CID 88883939
CID 88883939 (PubChem CID 88883939) has the molecular formula C11H24BN4O7 and a molecular weight of 335.15 g/mol.
| Compound Name | CID 88883939 |
|---|---|
| PubChem CID | 88883939 |
| Molecular Formula | C11H24BN4O7 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | — |
| SMILES | CO[B]NOCC(=O)NCCOCCOCCNC(=O)CON |
| InChI | InChI=1S/C11H24BN4O7/c1-19-12-16-23-9-11(18)15-3-5-21-7-6-20-4-2-14-10(17)8-22-13/h16H,2-9,13H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | QZQBPCDACAIWHF-UHFFFAOYSA-N |
| XLogP | -3.16 |
| TPSA | 142.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|