C12H24N3O5P — CID 144887822
2-methyl-N-[2-[2-[2-[[2-(phosphanylamino)oxyacetyl]amino]ethoxy]ethoxy]ethyl]prop-2-enamide (PubChem CID 144887822) has the molecular formula C12H24N3O5P and a molecular weight of 321.31 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-[[2-(phosphanylamino)oxyacetyl]amino]ethoxy]ethoxy]ethyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[2-[2-[2-[[2-(phosphanylamino)oxyacetyl]amino]ethoxy]ethoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 144887822 |
| Molecular Formula | C12H24N3O5P |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-[[2-(phosphanylamino)oxyacetyl]amino]ethoxy]ethoxy]ethyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCOCCOCCNC(=O)CONP |
| InChI | InChI=1S/C12H24N3O5P/c1-10(2)12(17)14-4-6-19-8-7-18-5-3-13-11(16)9-20-15-21/h15H,1,3-9,21H2,2H3,(H,13,16)(H,14,17) |
| InChIKey | CFQMDLJYOQNNQW-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|