C15H26N2O6 — CID 25221074
methyl 4-[2-[2-[2-(2-methylprop-2-enoylamino)ethoxy]ethoxy]ethylamino]-4-oxobutanoate (PubChem CID 25221074) has the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. Its IUPAC name is methyl 4-[2-[2-[2-(2-methylprop-2-enoylamino)ethoxy]ethoxy]ethylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[2-[2-[2-(2-methylprop-2-enoylamino)ethoxy]ethoxy]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 25221074 |
| Molecular Formula | C15H26N2O6 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | methyl 4-[2-[2-[2-(2-methylprop-2-enoylamino)ethoxy]ethoxy]ethylamino]-4-oxobutanoate |
| SMILES | C=C(C)C(=O)NCCOCCOCCNC(=O)CCC(=O)OC |
| InChI | InChI=1S/C15H26N2O6/c1-12(2)15(20)17-7-9-23-11-10-22-8-6-16-13(18)4-5-14(19)21-3/h1,4-11H2,2-3H3,(H,16,18)(H,17,20) |
| InChIKey | IVVFOSZSAGWYKG-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|