C17H26N2O9 — CID 58882709
2-[2-[3-[2-[(3-methoxy-3-oxopropanoyl)amino]ethylamino]-3-oxopropanoyl]oxyethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 58882709) has the molecular formula C17H26N2O9 and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-[2-[3-[2-[(3-methoxy-3-oxopropanoyl)amino]ethylamino]-3-oxopropanoyl]oxyethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[3-[2-[(3-methoxy-3-oxopropanoyl)amino]ethylamino]-3-oxopropanoyl]oxyethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58882709 |
| Molecular Formula | C17H26N2O9 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-[2-[3-[2-[(3-methoxy-3-oxopropanoyl)amino]ethylamino]-3-oxopropanoyl]oxyethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOC(=O)CC(=O)NCCNC(=O)CC(=O)OC |
| InChI | InChI=1S/C17H26N2O9/c1-12(2)17(24)28-9-7-26-6-8-27-16(23)11-14(21)19-5-4-18-13(20)10-15(22)25-3/h1,4-11H2,2-3H3,(H,18,20)(H,19,21) |
| InChIKey | KYUZFBSNBZCFAT-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|