C16H26O9 — CID 146182065
1-O-[2-(2-methoxyethoxy)ethyl] 2-O-[2-[2-(3-methylbut-3-enoyloxy)ethoxy]ethyl] oxalate (PubChem CID 146182065) has the molecular formula C16H26O9 and a molecular weight of 362.38 g/mol. Its IUPAC name is 1-O-[2-(2-methoxyethoxy)ethyl] 2-O-[2-[2-(3-methylbut-3-enoyloxy)ethoxy]ethyl] oxalate.
| Compound Name | 1-O-[2-(2-methoxyethoxy)ethyl] 2-O-[2-[2-(3-methylbut-3-enoyloxy)ethoxy]ethyl] oxalate |
|---|---|
| PubChem CID | 146182065 |
| Molecular Formula | C16H26O9 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-O-[2-(2-methoxyethoxy)ethyl] 2-O-[2-[2-(3-methylbut-3-enoyloxy)ethoxy]ethyl] oxalate |
| SMILES | C=C(C)CC(=O)OCCOCCOC(=O)C(=O)OCCOCCOC |
| InChI | InChI=1S/C16H26O9/c1-13(2)12-14(17)23-9-6-22-8-11-25-16(19)15(18)24-10-7-21-5-4-20-3/h1,4-12H2,2-3H3 |
| InChIKey | LGOPJIRXMNJDLI-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|