C12H20N2O4 — CID 138741807
ethyl 4-[2-(2-methylprop-2-enoylamino)ethylamino]-4-oxobutanoate (PubChem CID 138741807) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is ethyl 4-[2-(2-methylprop-2-enoylamino)ethylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[2-(2-methylprop-2-enoylamino)ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 138741807 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | ethyl 4-[2-(2-methylprop-2-enoylamino)ethylamino]-4-oxobutanoate |
| SMILES | C=C(C)C(=O)NCCNC(=O)CCC(=O)OCC |
| InChI | InChI=1S/C12H20N2O4/c1-4-18-11(16)6-5-10(15)13-7-8-14-12(17)9(2)3/h2,4-8H2,1,3H3,(H,13,15)(H,14,17) |
| InChIKey | BNLPLQANDDGEAE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|