C15H26N2O4 — CID 59532979
propan-2-yl 4-[4-(2-methylprop-2-enoylamino)butylamino]-4-oxobutanoate (PubChem CID 59532979) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is propan-2-yl 4-[4-(2-methylprop-2-enoylamino)butylamino]-4-oxobutanoate.
| Compound Name | propan-2-yl 4-[4-(2-methylprop-2-enoylamino)butylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 59532979 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | propan-2-yl 4-[4-(2-methylprop-2-enoylamino)butylamino]-4-oxobutanoate |
| SMILES | C=C(C)C(=O)NCCCCNC(=O)CCC(=O)OC(C)C |
| InChI | InChI=1S/C15H26N2O4/c1-11(2)15(20)17-10-6-5-9-16-13(18)7-8-14(19)21-12(3)4/h12H,1,5-10H2,2-4H3,(H,16,18)(H,17,20) |
| InChIKey | PFDXBWJRISLFNI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|