C14H23NO5 — CID 59532817
propan-2-yl 4-oxo-4-(4-prop-2-enoyloxybutylamino)butanoate (PubChem CID 59532817) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is propan-2-yl 4-oxo-4-(4-prop-2-enoyloxybutylamino)butanoate.
| Compound Name | propan-2-yl 4-oxo-4-(4-prop-2-enoyloxybutylamino)butanoate |
|---|---|
| PubChem CID | 59532817 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | propan-2-yl 4-oxo-4-(4-prop-2-enoyloxybutylamino)butanoate |
| SMILES | C=CC(=O)OCCCCNC(=O)CCC(=O)OC(C)C |
| InChI | InChI=1S/C14H23NO5/c1-4-13(17)19-10-6-5-9-15-12(16)7-8-14(18)20-11(2)3/h4,11H,1,5-10H2,2-3H3,(H,15,16) |
| InChIKey | LUTRGTQMTGRENZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|