C11H17CoNO5 — CID 173495817
[2-oxo-2-[3-oxo-3-[(3-oxo-3-propan-2-yloxypropyl)amino]propoxy]ethylidene]cobalt (PubChem CID 173495817) has the molecular formula C11H17CoNO5 and a molecular weight of 302.19 g/mol. Its IUPAC name is [2-oxo-2-[3-oxo-3-[(3-oxo-3-propan-2-yloxypropyl)amino]propoxy]ethylidene]cobalt.
| Compound Name | [2-oxo-2-[3-oxo-3-[(3-oxo-3-propan-2-yloxypropyl)amino]propoxy]ethylidene]cobalt |
|---|---|
| PubChem CID | 173495817 |
| Molecular Formula | C11H17CoNO5 |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | [2-oxo-2-[3-oxo-3-[(3-oxo-3-propan-2-yloxypropyl)amino]propoxy]ethylidene]cobalt |
| SMILES | CC(C)OC(=O)CCNC(=O)CCOC(=O)C=[Co] |
| InChI | InChI=1S/C11H17NO5.Co/c1-8(2)17-11(15)4-6-12-10(14)5-7-16-9(3)13;/h3,8H,4-7H2,1-2H3,(H,12,14); |
| InChIKey | TTZUQGDFIPENSQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |