C30H49NO5 — CID 170008540
1-O-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethyl] 5-O-propan-2-yl pentanedioate (PubChem CID 170008540) has the molecular formula C30H49NO5 and a molecular weight of 503.72 g/mol. Its IUPAC name is 1-O-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethyl] 5-O-propan-2-yl pentanedioate.
| Compound Name | 1-O-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethyl] 5-O-propan-2-yl pentanedioate |
|---|---|
| PubChem CID | 170008540 |
| Molecular Formula | C30H49NO5 |
| Molecular Weight | 503.72 g/mol |
| Exact Mass | 503.36 |
| IUPAC Name | 1-O-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethyl] 5-O-propan-2-yl pentanedioate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCOC(=O)CCCC(=O)OC(C)C |
| InChI | InChI=1S/C30H49NO5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-28(32)31-25-26-35-29(33)23-21-24-30(34)36-27(2)3/h8-9,11-12,14-15,17-18,27H,4-7,10,13,16,19-26H2,1-3H3,(H,31,32)/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | MCYFVXIRQDVVIV-GKFVBPDJSA-N |
| XLogP | 6.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.72 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|