C31H56N2O7P+ — CID 164732386
2-[hydroxy-[4-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]-4-oxobutoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 164732386) has the molecular formula C31H56N2O7P+ and a molecular weight of 599.77 g/mol. Its IUPAC name is 2-[hydroxy-[4-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]-4-oxobutoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[4-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]-4-oxobutoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 164732386 |
| Molecular Formula | C31H56N2O7P+ |
| Molecular Weight | 599.77 g/mol |
| Exact Mass | 599.38 |
| IUPAC Name | 2-[hydroxy-[4-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]-4-oxobutoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCOC(=O)CCCOP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C31H55N2O7P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-30(34)32-25-28-38-31(35)24-22-27-39-41(36,37)40-29-26-33(2,3)4/h9-10,12-13,15-16,18-19H,5-8,11,14,17,20-29H2,1-4H3,(H-,32,34,36,37)/p+1/b10-9-,13-12-,16-15-,19-18- |
| InChIKey | PWWNEZHORZHAHC-SNPVRQPZSA-O |
| XLogP | 6.41 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.77 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|