C51H86NO8P — CID 165323639
[2-hydroxy-3-[hydroxy-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] (11Z,14Z,17Z,20Z)-hexacosa-11,14,17,20-tetraenoate (PubChem CID 165323639) has the molecular formula C51H86NO8P and a molecular weight of 872.22 g/mol. Its IUPAC name is [2-hydroxy-3-[hydroxy-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] (11Z,14Z,17Z,20Z)-hexacosa-11,14,17,20-tetraenoate.
| Compound Name | [2-hydroxy-3-[hydroxy-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] (11Z,14Z,17Z,20Z)-hexacosa-11,14,17,20-tetraenoate |
|---|---|
| PubChem CID | 165323639 |
| Molecular Formula | C51H86NO8P |
| Molecular Weight | 872.22 g/mol |
| Exact Mass | 871.61 |
| IUPAC Name | [2-hydroxy-3-[hydroxy-[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]ethoxy]phosphoryl]oxypropyl] (11Z,14Z,17Z,20Z)-hexacosa-11,14,17,20-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OCC(O)COP(=O)(O)OCCNC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C51H86NO8P/c1-3-5-7-9-11-13-15-17-19-21-22-23-24-25-26-28-30-32-34-36-38-40-42-44-51(55)58-47-49(53)48-60-61(56,57)59-46-45-52-50(54)43-41-39-37-35-33-31-29-27-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,22-23,25-26,29,31,35,37,49,53H,3-10,15-16,21,24,27-28,30,32-34,36,38-48H2,1-2H3,(H,52,54)(H,56,57)/b13-11-,14-12-,19-17-,20-18-,23-22-,26-25-,31-29-,37-35- |
| InChIKey | XPUNXTADZLQUFN-VQFJCZQQSA-N |
| XLogP | 13.77 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.22 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|