C12H24IN3O2 — CID 111037123
propan-2-yl 3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111037123) has the molecular formula C12H24IN3O2 and a molecular weight of 369.25 g/mol. Its IUPAC name is propan-2-yl 3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | propan-2-yl 3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111037123 |
| Molecular Formula | C12H24IN3O2 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | propan-2-yl 3-[[N'-(cyclobutylmethyl)carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | CC(C)OC(=O)CCN/C(N)=N/CC1CCC1.I |
| InChI | InChI=1S/C12H23N3O2.HI/c1-9(2)17-11(16)6-7-14-12(13)15-8-10-4-3-5-10;/h9-10H,3-8H2,1-2H3,(H3,13,14,15);1H |
| InChIKey | SBXJNKKCZKCRAQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|