C9H19N3S — CID 111030376
2-(cyclobutylmethyl)-1-(2-methylsulfanylethyl)guanidine (PubChem CID 111030376) has the molecular formula C9H19N3S and a molecular weight of 201.34 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1-(2-methylsulfanylethyl)guanidine.
| Compound Name | 2-(cyclobutylmethyl)-1-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111030376 |
| Molecular Formula | C9H19N3S |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-(cyclobutylmethyl)-1-(2-methylsulfanylethyl)guanidine |
| SMILES | CSCCN/C(N)=N/CC1CCC1 |
| InChI | InChI=1S/C9H19N3S/c1-13-6-5-11-9(10)12-7-8-3-2-4-8/h8H,2-7H2,1H3,(H3,10,11,12) |
| InChIKey | PSYOSWVUOAROTN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|