C12H27IN4O2S — CID 111804893
2-(cyclobutylmethyl)-1-[2-(diethylsulfamoyl)ethyl]guanidine;hydroiodide (PubChem CID 111804893) has the molecular formula C12H27IN4O2S and a molecular weight of 418.35 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1-[2-(diethylsulfamoyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-(cyclobutylmethyl)-1-[2-(diethylsulfamoyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111804893 |
| Molecular Formula | C12H27IN4O2S |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-(cyclobutylmethyl)-1-[2-(diethylsulfamoyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN(CC)S(=O)(=O)CCN/C(N)=N/CC1CCC1.I |
| InChI | InChI=1S/C12H26N4O2S.HI/c1-3-16(4-2)19(17,18)9-8-14-12(13)15-10-11-6-5-7-11;/h11H,3-10H2,1-2H3,(H3,13,14,15);1H |
| InChIKey | HUQQRIPHDFIQLE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|