C14H22IN3O2S — CID 111065129
1-[2-(benzenesulfonyl)ethyl]-2-(cyclobutylmethyl)guanidine;hydroiodide (PubChem CID 111065129) has the molecular formula C14H22IN3O2S and a molecular weight of 423.32 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-2-(cyclobutylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-2-(cyclobutylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111065129 |
| Molecular Formula | C14H22IN3O2S |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-2-(cyclobutylmethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCC1)NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21N3O2S.HI/c15-14(17-11-12-5-4-6-12)16-9-10-20(18,19)13-7-2-1-3-8-13;/h1-3,7-8,12H,4-6,9-11H2,(H3,15,16,17);1H |
| InChIKey | RIFRXZAIMPACBP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|