C15H24IN3 — CID 111031290
2-(cyclobutylmethyl)-1-[2-(2-methylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111031290) has the molecular formula C15H24IN3 and a molecular weight of 373.28 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1-[2-(2-methylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-(cyclobutylmethyl)-1-[2-(2-methylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111031290 |
| Molecular Formula | C15H24IN3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-(cyclobutylmethyl)-1-[2-(2-methylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | Cc1ccccc1CCN/C(N)=N/CC1CCC1.I |
| InChI | InChI=1S/C15H23N3.HI/c1-12-5-2-3-8-14(12)9-10-17-15(16)18-11-13-6-4-7-13;/h2-3,5,8,13H,4,6-7,9-11H2,1H3,(H3,16,17,18);1H |
| InChIKey | OZPIJBOFMXTDIZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|