C17H24N2O4 — CID 51256546
propan-2-yl 3-(4-benzamidobutanoylamino)propanoate (PubChem CID 51256546) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is propan-2-yl 3-(4-benzamidobutanoylamino)propanoate.
| Compound Name | propan-2-yl 3-(4-benzamidobutanoylamino)propanoate |
|---|---|
| PubChem CID | 51256546 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | propan-2-yl 3-(4-benzamidobutanoylamino)propanoate |
| SMILES | CC(C)OC(=O)CCNC(=O)CCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24N2O4/c1-13(2)23-16(21)10-12-18-15(20)9-6-11-19-17(22)14-7-4-3-5-8-14/h3-5,7-8,13H,6,9-12H2,1-2H3,(H,18,20)(H,19,22) |
| InChIKey | XIKUZANPBNNZFO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|