C20H38N4O5 — CID 163793163
2-amino-4-methyl-N-[2-[2-[2-[4-(2-methylprop-2-enoylamino)butylamino]-2-oxoethoxy]ethoxy]ethyl]pentanamide (PubChem CID 163793163) has the molecular formula C20H38N4O5 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-amino-4-methyl-N-[2-[2-[2-[4-(2-methylprop-2-enoylamino)butylamino]-2-oxoethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 2-amino-4-methyl-N-[2-[2-[2-[4-(2-methylprop-2-enoylamino)butylamino]-2-oxoethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 163793163 |
| Molecular Formula | C20H38N4O5 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 2-amino-4-methyl-N-[2-[2-[2-[4-(2-methylprop-2-enoylamino)butylamino]-2-oxoethoxy]ethoxy]ethyl]pentanamide |
| SMILES | C=C(C)C(=O)NCCCCNC(=O)COCCOCCNC(=O)C(N)CC(C)C |
| InChI | InChI=1S/C20H38N4O5/c1-15(2)13-17(21)20(27)24-9-10-28-11-12-29-14-18(25)22-7-5-6-8-23-19(26)16(3)4/h15,17H,3,5-14,21H2,1-2,4H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | MYOUPBJNNOPZDO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|