C11H24N2O4S — CID 119803206
(2S)-2-amino-4-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]pentanamide (PubChem CID 119803206) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]pentanamide |
|---|---|
| PubChem CID | 119803206 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[2-(2-methylsulfonylethoxy)ethyl]pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NCCOCCS(C)(=O)=O |
| InChI | InChI=1S/C11H24N2O4S/c1-9(2)8-10(12)11(14)13-4-5-17-6-7-18(3,15)16/h9-10H,4-8,12H2,1-3H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | KQJVEDKTCCIGCW-JTQLQIEISA-N |
| XLogP | -0.46 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|