C15H32N4O5 — CID 177056741
2-[2-[4-(2-aminooxyethyl)piperazin-1-yl]ethoxy]-N-[2-(2-methoxyethoxy)ethyl]acetamide (PubChem CID 177056741) has the molecular formula C15H32N4O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-[2-[4-(2-aminooxyethyl)piperazin-1-yl]ethoxy]-N-[2-(2-methoxyethoxy)ethyl]acetamide.
| Compound Name | 2-[2-[4-(2-aminooxyethyl)piperazin-1-yl]ethoxy]-N-[2-(2-methoxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 177056741 |
| Molecular Formula | C15H32N4O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 2-[2-[4-(2-aminooxyethyl)piperazin-1-yl]ethoxy]-N-[2-(2-methoxyethoxy)ethyl]acetamide |
| SMILES | COCCOCCNC(=O)COCCN1CCN(CCON)CC1 |
| InChI | InChI=1S/C15H32N4O5/c1-21-12-13-22-9-2-17-15(20)14-23-10-7-18-3-5-19(6-4-18)8-11-24-16/h2-14,16H2,1H3,(H,17,20) |
| InChIKey | JNRQRBCDTDJYCK-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 98.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|