C12H24N2O3 — CID 113223173
2-(2-methoxyethoxy)-N-(2-piperidin-1-ylethyl)acetamide (PubChem CID 113223173) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(2-piperidin-1-ylethyl)acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(2-piperidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 113223173 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(2-piperidin-1-ylethyl)acetamide |
| SMILES | COCCOCC(=O)NCCN1CCCCC1 |
| InChI | InChI=1S/C12H24N2O3/c1-16-9-10-17-11-12(15)13-5-8-14-6-3-2-4-7-14/h2-11H2,1H3,(H,13,15) |
| InChIKey | XWKJOJSSKGTHRV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|