C14H29N5O2 — CID 111415663
N-(2-methoxyethyl)-2-[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]acetamide (PubChem CID 111415663) has the molecular formula C14H29N5O2 and a molecular weight of 299.42 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111415663 |
| Molecular Formula | C14H29N5O2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[N'-methyl-N-(2-piperidin-1-ylethyl)carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCCN1CCCCC1)NCC(=O)NCCOC |
| InChI | InChI=1S/C14H29N5O2/c1-15-14(18-12-13(20)16-7-11-21-2)17-6-10-19-8-4-3-5-9-19/h3-12H2,1-2H3,(H,16,20)(H2,15,17,18) |
| InChIKey | YIPPCNRWGVUYLP-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|