C14H29N5O4 — CID 111884421
tert-butyl N-[2-[[N-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate (PubChem CID 111884421) has the molecular formula C14H29N5O4 and a molecular weight of 331.42 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111884421 |
| Molecular Formula | C14H29N5O4 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | tert-butyl N-[2-[[N-[2-(2-methoxyethylamino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate |
| SMILES | C/N=C(/NCCNC(=O)OC(C)(C)C)NCC(=O)NCCOC |
| InChI | InChI=1S/C14H29N5O4/c1-14(2,3)23-13(21)18-7-6-17-12(15-4)19-10-11(20)16-8-9-22-5/h6-10H2,1-5H3,(H,16,20)(H,18,21)(H2,15,17,19) |
| InChIKey | CHPDMQRTKXJPDC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|