C14H28N4O3 — CID 111391361
2-[[N-[3-(cyclopropylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111391361) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[[N-[3-(cyclopropylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[N-[3-(cyclopropylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111391361 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2-[[N-[3-(cyclopropylmethoxy)propyl]-N'-methylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | C/N=C(/NCCCOCC1CC1)NCC(=O)NCCOC |
| InChI | InChI=1S/C14H28N4O3/c1-15-14(18-10-13(19)16-7-9-20-2)17-6-3-8-21-11-12-4-5-12/h12H,3-11H2,1-2H3,(H,16,19)(H2,15,17,18) |
| InChIKey | BDGIUIPABMOWKK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|