C16H33N5O3 — CID 110942424
tert-butyl 4-[2-[[N-(2-methoxyethyl)-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate (PubChem CID 110942424) has the molecular formula C16H33N5O3 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl 4-[2-[[N-(2-methoxyethyl)-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[N-(2-methoxyethyl)-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110942424 |
| Molecular Formula | C16H33N5O3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | tert-butyl 4-[2-[[N-(2-methoxyethyl)-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
| SMILES | C/N=C(\NCCOC)NCCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H33N5O3/c1-16(2,3)24-15(22)21-11-9-20(10-12-21)8-6-18-14(17-4)19-7-13-23-5/h6-13H2,1-5H3,(H2,17,18,19) |
| InChIKey | RWTORCWYCIMVLU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|