C18H38IN5O2S — CID 111626283
tert-butyl 4-[2-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111626283) has the molecular formula C18H38IN5O2S and a molecular weight of 515.51 g/mol. Its IUPAC name is tert-butyl 4-[2-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[2-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111626283 |
| Molecular Formula | C18H38IN5O2S |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | tert-butyl 4-[2-[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCCCSC)NCCN1CCN(C(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C18H37N5O2S.HI/c1-18(2,3)25-17(24)23-13-11-22(12-14-23)10-9-21-16(19-4)20-8-6-7-15-26-5;/h6-15H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | VNTMSLYWEKAKQE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|