C19H38IN5O2S — CID 111530406
tert-butyl 4-[2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111530406) has the molecular formula C19H38IN5O2S and a molecular weight of 527.52 g/mol. Its IUPAC name is tert-butyl 4-[2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111530406 |
| Molecular Formula | C19H38IN5O2S |
| Molecular Weight | 527.52 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | tert-butyl 4-[2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]ethyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCN1CCN(C(=O)OC(C)(C)C)CC1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C19H37N5O2S.HI/c1-19(2,3)26-18(25)24-12-10-23(11-13-24)9-8-21-17(20-4)22-15-6-7-16(14-15)27-5;/h15-16H,6-14H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | XLFKZHCEIXMDPA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|