C16H33IN4O2S — CID 111529092
tert-butyl N-methyl-N-[2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111529092) has the molecular formula C16H33IN4O2S and a molecular weight of 472.44 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-methyl-N-[2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111529092 |
| Molecular Formula | C16H33IN4O2S |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCN(C)C(=O)OC(C)(C)C)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C16H32N4O2S.HI/c1-16(2,3)22-15(21)20(5)10-9-18-14(17-4)19-12-7-8-13(11-12)23-6;/h12-13H,7-11H2,1-6H3,(H2,17,18,19);1H |
| InChIKey | BMGUZVLDQDGEPQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|