C18H36N4O3S — CID 109439579
tert-butyl N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 109439579) has the molecular formula C18H36N4O3S and a molecular weight of 388.58 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 109439579 |
| Molecular Formula | C18H36N4O3S |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | tert-butyl N-[2-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCN(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H36N4O3S/c1-7-26(24)15-10-8-9-14(13-15)21-16(19-5)20-11-12-22(6)17(23)25-18(2,3)4/h14-15H,7-13H2,1-6H3,(H2,19,20,21) |
| InChIKey | VUUCKXWESKHGIN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|