C16H31N3O3S — CID 109436973
propan-2-yl 3-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]propanoate (PubChem CID 109436973) has the molecular formula C16H31N3O3S and a molecular weight of 345.51 g/mol. Its IUPAC name is propan-2-yl 3-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]propanoate.
| Compound Name | propan-2-yl 3-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]propanoate |
|---|---|
| PubChem CID | 109436973 |
| Molecular Formula | C16H31N3O3S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | propan-2-yl 3-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]propanoate |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCC(=O)OC(C)C)C1 |
| InChI | InChI=1S/C16H31N3O3S/c1-5-23(21)14-8-6-7-13(11-14)19-16(17-4)18-10-9-15(20)22-12(2)3/h12-14H,5-11H2,1-4H3,(H2,17,18,19) |
| InChIKey | YJIVEXDZKAHZLJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|