C17H35IN4O2S — CID 109436840
N-butan-2-yl-3-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 109436840) has the molecular formula C17H35IN4O2S and a molecular weight of 486.46 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-butan-2-yl-3-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 109436840 |
| Molecular Formula | C17H35IN4O2S |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | N-butan-2-yl-3-[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCC(C)NC(=O)CCN/C(=N\C)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C17H34N4O2S.HI/c1-5-13(3)20-16(22)10-11-19-17(18-4)21-14-8-7-9-15(12-14)24(23)6-2;/h13-15H,5-12H2,1-4H3,(H,20,22)(H2,18,19,21);1H |
| InChIKey | RVKYTOWCUOVNEC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|