C15H30IN3OS — CID 109440028
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(E)-pent-3-enyl]guanidine;hydroiodide (PubChem CID 109440028) has the molecular formula C15H30IN3OS and a molecular weight of 427.40 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(E)-pent-3-enyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(E)-pent-3-enyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109440028 |
| Molecular Formula | C15H30IN3OS |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(E)-pent-3-enyl]guanidine;hydroiodide |
| SMILES | C/C=C/CCN/C(=N\C)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C15H29N3OS.HI/c1-4-6-7-11-17-15(16-3)18-13-9-8-10-14(12-13)20(19)5-2;/h4,6,13-14H,5,7-12H2,1-3H3,(H2,16,17,18);1H/b6-4+; |
| InChIKey | FZIAQYGSDCEGMF-CVDVRWGVSA-N |
| XLogP | 2.82 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|