C19H39IN4O3S — CID 109439304
tert-butyl N-[2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide (PubChem CID 109439304) has the molecular formula C19H39IN4O3S and a molecular weight of 530.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 109439304 |
| Molecular Formula | C19H39IN4O3S |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)C(=O)OC(C)(C)C)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C19H38N4O3S.HI/c1-7-20-17(21-12-13-23(6)18(24)26-19(3,4)5)22-15-10-9-11-16(14-15)27(25)8-2;/h15-16H,7-14H2,1-6H3,(H2,20,21,22);1H |
| InChIKey | BPGVTZGZFKWGMG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|