C17H34N4O3 — CID 111190918
tert-butyl N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]-N-methylcarbamate (PubChem CID 111190918) has the molecular formula C17H34N4O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 111190918 |
| Molecular Formula | C17H34N4O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[(4-hydroxycyclohexyl)amino]methylidene]amino]ethyl]-N-methylcarbamate |
| SMILES | CCN/C(=N\CCN(C)C(=O)OC(C)(C)C)NC1CCC(O)CC1 |
| InChI | InChI=1S/C17H34N4O3/c1-6-18-15(20-13-7-9-14(22)10-8-13)19-11-12-21(5)16(23)24-17(2,3)4/h13-14,22H,6-12H2,1-5H3,(H2,18,19,20) |
| InChIKey | JLJUGKBNYZCOPB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|