C13H26N4OS — CID 111529367
N,N-dimethyl-3-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]propanamide (PubChem CID 111529367) has the molecular formula C13H26N4OS and a molecular weight of 286.44 g/mol. Its IUPAC name is N,N-dimethyl-3-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]propanamide.
| Compound Name | N,N-dimethyl-3-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111529367 |
| Molecular Formula | C13H26N4OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | N,N-dimethyl-3-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCC(=O)N(C)C)NC1CCC(SC)C1 |
| InChI | InChI=1S/C13H26N4OS/c1-14-13(15-8-7-12(18)17(2)3)16-10-5-6-11(9-10)19-4/h10-11H,5-9H2,1-4H3,(H2,14,15,16) |
| InChIKey | PNOKHWAOGPFTBF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|