C14H28N4OS — CID 111529183
N-tert-butyl-2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]acetamide (PubChem CID 111529183) has the molecular formula C14H28N4OS and a molecular weight of 300.47 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111529183 |
| Molecular Formula | C14H28N4OS |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-(3-methylsulfanylcyclopentyl)carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NC1CCC(SC)C1 |
| InChI | InChI=1S/C14H28N4OS/c1-14(2,3)18-12(19)9-16-13(15-4)17-10-6-7-11(8-10)20-5/h10-11H,6-9H2,1-5H3,(H,18,19)(H2,15,16,17) |
| InChIKey | CCUBKLPJJVQAGE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|