C14H28N4S — CID 111530711
2-methyl-1-[(1-methylpyrrolidin-3-yl)methyl]-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111530711) has the molecular formula C14H28N4S and a molecular weight of 284.47 g/mol. Its IUPAC name is 2-methyl-1-[(1-methylpyrrolidin-3-yl)methyl]-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 2-methyl-1-[(1-methylpyrrolidin-3-yl)methyl]-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111530711 |
| Molecular Formula | C14H28N4S |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-methyl-1-[(1-methylpyrrolidin-3-yl)methyl]-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | C/N=C(\NCC1CCN(C)C1)NC1CCC(SC)C1 |
| InChI | InChI=1S/C14H28N4S/c1-15-14(16-9-11-6-7-18(2)10-11)17-12-4-5-13(8-12)19-3/h11-13H,4-10H2,1-3H3,(H2,15,16,17) |
| InChIKey | TYOMUJSSXPPEMB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|