C20H41N5O3 — CID 111709471
tert-butyl 4-[2-[[N-(2-methoxy-3,3-dimethylbutyl)-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate (PubChem CID 111709471) has the molecular formula C20H41N5O3 and a molecular weight of 399.58 g/mol. Its IUPAC name is tert-butyl 4-[2-[[N-(2-methoxy-3,3-dimethylbutyl)-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[N-(2-methoxy-3,3-dimethylbutyl)-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111709471 |
| Molecular Formula | C20H41N5O3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.32 |
| IUPAC Name | tert-butyl 4-[2-[[N-(2-methoxy-3,3-dimethylbutyl)-N'-methylcarbamimidoyl]amino]ethyl]piperazine-1-carboxylate |
| SMILES | C/N=C(/NCCN1CCN(C(=O)OC(C)(C)C)CC1)NCC(OC)C(C)(C)C |
| InChI | InChI=1S/C20H41N5O3/c1-19(2,3)16(27-8)15-23-17(21-7)22-9-10-24-11-13-25(14-12-24)18(26)28-20(4,5)6/h16H,9-15H2,1-8H3,(H2,21,22,23) |
| InChIKey | BRSGVIHEEYDXHI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|