C14H31IN4O4 — CID 111883818
tert-butyl N-[2-[[N-[2-(2-methoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111883818) has the molecular formula C14H31IN4O4 and a molecular weight of 446.33 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[2-(2-methoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-[2-(2-methoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111883818 |
| Molecular Formula | C14H31IN4O4 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | tert-butyl N-[2-[[N-[2-(2-methoxyethoxy)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(/NCCNC(=O)OC(C)(C)C)NCCOCCOC.I |
| InChI | InChI=1S/C14H30N4O4.HI/c1-14(2,3)22-13(19)18-7-6-16-12(15-4)17-8-9-21-11-10-20-5;/h6-11H2,1-5H3,(H,18,19)(H2,15,16,17);1H |
| InChIKey | NVSBMIKIWKLYGT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|