C17H37N5O4 — CID 177054296
2-[2-[4-[2-[2-(aminomethylamino)-2-oxoethoxy]ethyl]piperazin-1-yl]ethoxy]-N-ethylacetamide;ethane (PubChem CID 177054296) has the molecular formula C17H37N5O4 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-[2-[4-[2-[2-(aminomethylamino)-2-oxoethoxy]ethyl]piperazin-1-yl]ethoxy]-N-ethylacetamide;ethane.
| Compound Name | 2-[2-[4-[2-[2-(aminomethylamino)-2-oxoethoxy]ethyl]piperazin-1-yl]ethoxy]-N-ethylacetamide;ethane |
|---|---|
| PubChem CID | 177054296 |
| Molecular Formula | C17H37N5O4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.28 |
| IUPAC Name | 2-[2-[4-[2-[2-(aminomethylamino)-2-oxoethoxy]ethyl]piperazin-1-yl]ethoxy]-N-ethylacetamide;ethane |
| SMILES | CC.CCNC(=O)COCCN1CCN(CCOCC(=O)NCN)CC1 |
| InChI | InChI=1S/C15H31N5O4.C2H6/c1-2-17-14(21)11-23-9-7-19-3-5-20(6-4-19)8-10-24-12-15(22)18-13-16;1-2/h2-13,16H2,1H3,(H,17,21)(H,18,22);1-2H3 |
| InChIKey | XXQRBEKTFGCVBH-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|