About 2-(aziridin-1-yl)ethyl N-ethylcarbamate
2-(aziridin-1-yl)ethyl N-ethylcarbamate (PubChem CID 20801404) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(aziridin-1-yl)ethyl N-ethylcarbamate.
Molecular Properties
| Compound Name | 2-(aziridin-1-yl)ethyl N-ethylcarbamate |
| PubChem CID | 20801404 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-(aziridin-1-yl)ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCN1CC1 |
| InChI | InChI=1S/C7H14N2O2/c1-2-8-7(10)11-6-5-9-3-4-9/h2-6H2,1H3,(H,8,10) |
| InChIKey | NHOAIWIIVGMPMM-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 41.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(aziridin-1-yl)ethyl N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aziridin-1-yl)ethyl N-ethylcarbamate?
The IUPAC name of 2-(aziridin-1-yl)ethyl N-ethylcarbamate (CID 20801404) is 2-(aziridin-1-yl)ethyl N-ethylcarbamate.
What is the SMILES notation for 2-(aziridin-1-yl)ethyl N-ethylcarbamate?
The canonical SMILES for 2-(aziridin-1-yl)ethyl N-ethylcarbamate is CCNC(=O)OCCN1CC1.
What is the InChIKey of 2-(aziridin-1-yl)ethyl N-ethylcarbamate?
The InChIKey is NHOAIWIIVGMPMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-2-8-7(10)11-6-5-9-3-4-9/h2-6H2,1H3,(H,8,10).
What are the key properties of 2-(aziridin-1-yl)ethyl N-ethylcarbamate?
2-(aziridin-1-yl)ethyl N-ethylcarbamate has a molecular weight of 158.20 g/mol, XLogP of 0.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aziridin-1-yl)ethyl N-ethylcarbamate is sourced from PubChem (CID 20801404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).