About ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate
ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate (PubChem CID 156869233) has the molecular formula C14H33N3O2
and a molecular weight of 275.44 g/mol. Its IUPAC name is ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate.
Molecular Properties
| Compound Name | ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate |
| PubChem CID | 156869233 |
| Molecular Formula | C14H33N3O2 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate |
| SMILES | CC.CC.CCOC(=O)NCCN1CCN(C)CC1 |
| InChI | InChI=1S/C10H21N3O2.2C2H6/c1-3-15-10(14)11-4-5-13-8-6-12(2)7-9-13;2*1-2/h3-9H2,1-2H3,(H,11,14);2*1-2H3 |
| InChIKey | KPAQGUSPIXGADA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate?
The IUPAC name of ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate (CID 156869233) is ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate.
What is the SMILES notation for ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate?
The canonical SMILES for ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate is CC.CC.CCOC(=O)NCCN1CCN(C)CC1.
What is the InChIKey of ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate?
The InChIKey is KPAQGUSPIXGADA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O2.2C2H6/c1-3-15-10(14)11-4-5-13-8-6-12(2)7-9-13;2*1-2/h3-9H2,1-2H3,(H,11,14);2*1-2H3.
What are the key properties of ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate?
ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate has a molecular weight of 275.44 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate is sourced from PubChem (CID 156869233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).