C9H20N4O — CID 59006454
1-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]urea (PubChem CID 59006454) has the molecular formula C9H20N4O and a molecular weight of 200.29 g/mol. Its IUPAC name is 1-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]urea.
| Compound Name | 1-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 59006454 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]urea |
| SMILES | CNC(=O)NCCN1CCN(C)CC1 |
| InChI | InChI=1S/C9H20N4O/c1-10-9(14)11-3-4-13-7-5-12(2)6-8-13/h3-8H2,1-2H3,(H2,10,11,14) |
| InChIKey | PZKKWWZQBWBGSV-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |