About 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea
1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea (PubChem CID 77059127) has the molecular formula C9H17F2N3O
and a molecular weight of 221.25 g/mol. Its IUPAC name is 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea.
Molecular Properties
| Compound Name | 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea |
| PubChem CID | 77059127 |
| Molecular Formula | C9H17F2N3O |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea |
| SMILES | CNC(=O)NCCN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H17F2N3O/c1-12-8(15)13-4-7-14-5-2-9(10,11)3-6-14/h2-7H2,1H3,(H2,12,13,15) |
| InChIKey | FPTHUGBUPKPXGG-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea?
The IUPAC name of 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea (CID 77059127) is 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea.
What is the SMILES notation for 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea?
The canonical SMILES for 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea is CNC(=O)NCCN1CCC(F)(F)CC1.
What is the InChIKey of 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea?
The InChIKey is FPTHUGBUPKPXGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2N3O/c1-12-8(15)13-4-7-14-5-2-9(10,11)3-6-14/h2-7H2,1H3,(H2,12,13,15).
What are the key properties of 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea?
1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea has a molecular weight of 221.25 g/mol, XLogP of 0.65, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylurea is sourced from PubChem (CID 77059127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).