C12H17F2NO4 — CID 141430800
(E)-2-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylbut-2-enedioic acid (PubChem CID 141430800) has the molecular formula C12H17F2NO4 and a molecular weight of 277.27 g/mol. Its IUPAC name is (E)-2-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylbut-2-enedioic acid.
| Compound Name | (E)-2-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylbut-2-enedioic acid |
|---|---|
| PubChem CID | 141430800 |
| Molecular Formula | C12H17F2NO4 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (E)-2-[2-(4,4-difluoropiperidin-1-yl)ethyl]-3-methylbut-2-enedioic acid |
| SMILES | C/C(C(=O)O)=C(/CCN1CCC(F)(F)CC1)C(=O)O |
| InChI | InChI=1S/C12H17F2NO4/c1-8(10(16)17)9(11(18)19)2-5-15-6-3-12(13,14)4-7-15/h2-7H2,1H3,(H,16,17)(H,18,19)/b9-8+ |
| InChIKey | GUWDOQKSXASXHZ-CMDGGOBGSA-N |
| XLogP | 1.59 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|