About 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine
4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine (PubChem CID 117007742) has the molecular formula C11H20F2N2O
and a molecular weight of 234.29 g/mol. Its IUPAC name is 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine |
| PubChem CID | 117007742 |
| Molecular Formula | C11H20F2N2O |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine |
| SMILES | FC1(F)CCN(CCN2CCOCC2)CC1 |
| InChI | InChI=1S/C11H20F2N2O/c12-11(13)1-3-14(4-2-11)5-6-15-7-9-16-10-8-15/h1-10H2 |
| InChIKey | AMHXFJHAXANWON-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine?
The IUPAC name of 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine (CID 117007742) is 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine.
What is the SMILES notation for 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine?
The canonical SMILES for 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine is FC1(F)CCN(CCN2CCOCC2)CC1.
What is the InChIKey of 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine?
The InChIKey is AMHXFJHAXANWON-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2O/c12-11(13)1-3-14(4-2-11)5-6-15-7-9-16-10-8-15/h1-10H2.
What are the key properties of 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine?
4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine has a molecular weight of 234.29 g/mol, XLogP of 1.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine is sourced from PubChem (CID 117007742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).